C16H11F2NO2 — CID 12056636
4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]benzaldehyde (PubChem CID 12056636) has the molecular formula C16H11F2NO2 and a molecular weight of 287.26 g/mol. Its IUPAC name is 4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]benzaldehyde.
| Compound Name | 4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]benzaldehyde |
|---|---|
| PubChem CID | 12056636 |
| Molecular Formula | C16H11F2NO2 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]benzaldehyde |
| SMILES | O=Cc1ccc(C2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C16H11F2NO2/c17-12-2-1-3-13(18)15(12)16-19-14(9-21-16)11-6-4-10(8-20)5-7-11/h1-8,14H,9H2 |
| InChIKey | GNGRPBPJYRGGAF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|