C23H17F2NO — CID 12056637
2-(2,6-difluorophenyl)-4-[4-[(E)-2-phenylethenyl]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 12056637) has the molecular formula C23H17F2NO and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[4-[(E)-2-phenylethenyl]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-[4-[(E)-2-phenylethenyl]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 12056637 |
| Molecular Formula | C23H17F2NO |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[4-[(E)-2-phenylethenyl]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccc(/C=C/c3ccccc3)cc2)CO1 |
| InChI | InChI=1S/C23H17F2NO/c24-19-7-4-8-20(25)22(19)23-26-21(15-27-23)18-13-11-17(12-14-18)10-9-16-5-2-1-3-6-16/h1-14,21H,15H2/b10-9+ |
| InChIKey | ITYIIUPTDCJJET-MDZDMXLPSA-N |
| XLogP | 5.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|