C15H19ClN2OS — CID 120567142
N-(4-methylpiperidin-4-yl)-1-benzothiophene-2-carboxamide;hydrochloride (PubChem CID 120567142) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is N-(4-methylpiperidin-4-yl)-1-benzothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(4-methylpiperidin-4-yl)-1-benzothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120567142 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(4-methylpiperidin-4-yl)-1-benzothiophene-2-carboxamide;hydrochloride |
| SMILES | CC1(NC(=O)c2cc3ccccc3s2)CCNCC1.Cl |
| InChI | InChI=1S/C15H18N2OS.ClH/c1-15(6-8-16-9-7-15)17-14(18)13-10-11-4-2-3-5-12(11)19-13;/h2-5,10,16H,6-9H2,1H3,(H,17,18);1H |
| InChIKey | DXGNREJIGGAKHA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |