C19H29ClN4O — CID 120568461
N-(5-amino-2-methylphenyl)-3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanamide;hydrochloride (PubChem CID 120568461) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120568461 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)CCc1c(C)nn(CC(C)C)c1C.Cl |
| InChI | InChI=1S/C19H28N4O.ClH/c1-12(2)11-23-15(5)17(14(4)22-23)8-9-19(24)21-18-10-16(20)7-6-13(18)3;/h6-7,10,12H,8-9,11,20H2,1-5H3,(H,21,24);1H |
| InChIKey | PDDUZGMODOFSOJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|