C18H14F4O4 — CID 12056885
4-oxo-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]butanoic acid (PubChem CID 12056885) has the molecular formula C18H14F4O4 and a molecular weight of 370.30 g/mol. Its IUPAC name is 4-oxo-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]butanoic acid.
| Compound Name | 4-oxo-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 12056885 |
| Molecular Formula | C18H14F4O4 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-oxo-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(-c2ccc(OC(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H14F4O4/c19-17(20)18(21,22)26-14-7-5-12(6-8-14)11-1-3-13(4-2-11)15(23)9-10-16(24)25/h1-8,17H,9-10H2,(H,24,25) |
| InChIKey | YLZBOEDPRWATCC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|