C19H19F3N4O — CID 120568854
N-(5-amino-2-methylphenyl)-1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxamide (PubChem CID 120568854) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxamide.
| Compound Name | N-(5-amino-2-methylphenyl)-1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 120568854 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(N)cc1NC(=O)c1ccc2c(c1)nc(C(F)(F)F)n2C(C)C |
| InChI | InChI=1S/C19H19F3N4O/c1-10(2)26-16-7-5-12(8-15(16)25-18(26)19(20,21)22)17(27)24-14-9-13(23)6-4-11(14)3/h4-10H,23H2,1-3H3,(H,24,27) |
| InChIKey | MNRLLTSUXIPHIT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|