C13H23ClN4O3 — CID 120571022
1-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione;hydrochloride (PubChem CID 120571022) has the molecular formula C13H23ClN4O3 and a molecular weight of 318.81 g/mol. Its IUPAC name is 1-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 1-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 120571022 |
| Molecular Formula | C13H23ClN4O3 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[2-(2,3-dimethylpiperazin-1-yl)-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione;hydrochloride |
| SMILES | CC1NCCN(C(=O)CN2C(=O)NC(=O)C2(C)C)C1C.Cl |
| InChI | InChI=1S/C13H22N4O3.ClH/c1-8-9(2)16(6-5-14-8)10(18)7-17-12(20)15-11(19)13(17,3)4;/h8-9,14H,5-7H2,1-4H3,(H,15,19,20);1H |
| InChIKey | WRRCGBKECMCIGK-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|