C16H23N3O3S — CID 120572157
4-(2,3-dimethylpiperazine-1-carbonyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 120572157) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperazine-1-carbonyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-(2,3-dimethylpiperazine-1-carbonyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 120572157 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-(2,3-dimethylpiperazine-1-carbonyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)N2CCNC(C)C2C)cc1 |
| InChI | InChI=1S/C16H23N3O3S/c1-4-9-18-23(21,22)15-7-5-14(6-8-15)16(20)19-11-10-17-12(2)13(19)3/h4-8,12-13,17-18H,1,9-11H2,2-3H3 |
| InChIKey | GZUJNFKVOBPYBT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|