About 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride
1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride (PubChem CID 120572802) has the molecular formula C13H23Cl2N3OS
and a molecular weight of 340.32 g/mol. Its IUPAC name is 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride.
Molecular Properties
| Compound Name | 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride |
| PubChem CID | 120572802 |
| Molecular Formula | C13H23Cl2N3OS |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride |
| SMILES | CCc1nc(CC(=O)N2CCNC(C)C2C)cs1.Cl.Cl |
| InChI | InChI=1S/C13H21N3OS.2ClH/c1-4-12-15-11(8-18-12)7-13(17)16-6-5-14-9(2)10(16)3;;/h8-10,14H,4-7H2,1-3H3;2*1H |
| InChIKey | AYKXEMPOUSWYNQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride?
The IUPAC name of 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride (CID 120572802) is 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride.
What is the SMILES notation for 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride?
The canonical SMILES for 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride is CCc1nc(CC(=O)N2CCNC(C)C2C)cs1.Cl.Cl.
What is the InChIKey of 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride?
The InChIKey is AYKXEMPOUSWYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3OS.2ClH/c1-4-12-15-11(8-18-12)7-13(17)16-6-5-14-9(2)10(16)3;;/h8-10,14H,4-7H2,1-3H3;2*1H.
What are the key properties of 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride?
1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride has a molecular weight of 340.32 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylpiperazin-1-yl)-2-(2-ethyl-1,3-thiazol-4-yl)ethanone;dihydrochloride is sourced from PubChem (CID 120572802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).