C14H28ClN3O2 — CID 120573407
3-methyl-N-[3-[(2-methylpiperidin-3-yl)amino]-3-oxopropyl]butanamide;hydrochloride (PubChem CID 120573407) has the molecular formula C14H28ClN3O2 and a molecular weight of 305.85 g/mol. Its IUPAC name is 3-methyl-N-[3-[(2-methylpiperidin-3-yl)amino]-3-oxopropyl]butanamide;hydrochloride.
| Compound Name | 3-methyl-N-[3-[(2-methylpiperidin-3-yl)amino]-3-oxopropyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120573407 |
| Molecular Formula | C14H28ClN3O2 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 3-methyl-N-[3-[(2-methylpiperidin-3-yl)amino]-3-oxopropyl]butanamide;hydrochloride |
| SMILES | CC(C)CC(=O)NCCC(=O)NC1CCCNC1C.Cl |
| InChI | InChI=1S/C14H27N3O2.ClH/c1-10(2)9-14(19)16-8-6-13(18)17-12-5-4-7-15-11(12)3;/h10-12,15H,4-9H2,1-3H3,(H,16,19)(H,17,18);1H |
| InChIKey | JELASGSWIJWIFX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |