C15H22BrClN2OS — CID 120573590
3-(2-bromophenyl)sulfanyl-N-(2-methylpiperidin-3-yl)propanamide;hydrochloride (PubChem CID 120573590) has the molecular formula C15H22BrClN2OS and a molecular weight of 393.78 g/mol. Its IUPAC name is 3-(2-bromophenyl)sulfanyl-N-(2-methylpiperidin-3-yl)propanamide;hydrochloride.
| Compound Name | 3-(2-bromophenyl)sulfanyl-N-(2-methylpiperidin-3-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120573590 |
| Molecular Formula | C15H22BrClN2OS |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 3-(2-bromophenyl)sulfanyl-N-(2-methylpiperidin-3-yl)propanamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)CCSc1ccccc1Br.Cl |
| InChI | InChI=1S/C15H21BrN2OS.ClH/c1-11-13(6-4-9-17-11)18-15(19)8-10-20-14-7-3-2-5-12(14)16;/h2-3,5,7,11,13,17H,4,6,8-10H2,1H3,(H,18,19);1H |
| InChIKey | GMNSIOGLUJSCHD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |