C18H24ClN3O2 — CID 120573600
7-methoxy-2-methyl-N-(2-methylpiperidin-3-yl)quinoline-3-carboxamide;hydrochloride (PubChem CID 120573600) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 7-methoxy-2-methyl-N-(2-methylpiperidin-3-yl)quinoline-3-carboxamide;hydrochloride.
| Compound Name | 7-methoxy-2-methyl-N-(2-methylpiperidin-3-yl)quinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120573600 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 7-methoxy-2-methyl-N-(2-methylpiperidin-3-yl)quinoline-3-carboxamide;hydrochloride |
| SMILES | COc1ccc2cc(C(=O)NC3CCCNC3C)c(C)nc2c1.Cl |
| InChI | InChI=1S/C18H23N3O2.ClH/c1-11-15(18(22)21-16-5-4-8-19-12(16)2)9-13-6-7-14(23-3)10-17(13)20-11;/h6-7,9-10,12,16,19H,4-5,8H2,1-3H3,(H,21,22);1H |
| InChIKey | GBNKLYAUDIIBAR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |