C19H23N3O2S — CID 120574736
N-[[4-[(2-methylpiperidin-3-yl)carbamoyl]phenyl]methyl]thiophene-2-carboxamide (PubChem CID 120574736) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[[4-[(2-methylpiperidin-3-yl)carbamoyl]phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-[(2-methylpiperidin-3-yl)carbamoyl]phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 120574736 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[[4-[(2-methylpiperidin-3-yl)carbamoyl]phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CC1NCCCC1NC(=O)c1ccc(CNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H23N3O2S/c1-13-16(4-2-10-20-13)22-18(23)15-8-6-14(7-9-15)12-21-19(24)17-5-3-11-25-17/h3,5-9,11,13,16,20H,2,4,10,12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | HWQSIGNOFGRQKD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |