C13H15Cl2FN2O — CID 120575501
2,4-dichloro-5-fluoro-N-(2-methylpiperidin-3-yl)benzamide (PubChem CID 120575501) has the molecular formula C13H15Cl2FN2O and a molecular weight of 305.18 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(2-methylpiperidin-3-yl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(2-methylpiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 120575501 |
| Molecular Formula | C13H15Cl2FN2O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(2-methylpiperidin-3-yl)benzamide |
| SMILES | CC1NCCCC1NC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2FN2O/c1-7-12(3-2-4-17-7)18-13(19)8-5-11(16)10(15)6-9(8)14/h5-7,12,17H,2-4H2,1H3,(H,18,19) |
| InChIKey | VBJKNVVCDYHBPR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|