C20H25ClN4O2 — CID 120577264
N-(2-methylpiperidin-3-yl)-4-(phenylcarbamoylamino)benzamide;hydrochloride (PubChem CID 120577264) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-4-(phenylcarbamoylamino)benzamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-3-yl)-4-(phenylcarbamoylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120577264 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-4-(phenylcarbamoylamino)benzamide;hydrochloride |
| SMILES | CC1NCCCC1NC(=O)c1ccc(NC(=O)Nc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H24N4O2.ClH/c1-14-18(8-5-13-21-14)24-19(25)15-9-11-17(12-10-15)23-20(26)22-16-6-3-2-4-7-16;/h2-4,6-7,9-12,14,18,21H,5,8,13H2,1H3,(H,24,25)(H2,22,23,26);1H |
| InChIKey | FRFPFTDEHSYIQP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |