C15H28N4O3 — CID 120578111
N-[2-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-2-oxoethyl]butanamide (PubChem CID 120578111) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[2-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-2-oxoethyl]butanamide.
| Compound Name | N-[2-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 120578111 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-[2-[2-[(3-aminopropanoylamino)methyl]piperidin-1-yl]-2-oxoethyl]butanamide |
| SMILES | CCCC(=O)NCC(=O)N1CCCCC1CNC(=O)CCN |
| InChI | InChI=1S/C15H28N4O3/c1-2-5-13(20)18-11-15(22)19-9-4-3-6-12(19)10-17-14(21)7-8-16/h12H,2-11,16H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | YISWUYCOHMEEJN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |