C16H21Cl2N3O2 — CID 120578289
3-amino-N-[[1-(3,4-dichlorobenzoyl)piperidin-2-yl]methyl]propanamide (PubChem CID 120578289) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 3-amino-N-[[1-(3,4-dichlorobenzoyl)piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-(3,4-dichlorobenzoyl)piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120578289 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-amino-N-[[1-(3,4-dichlorobenzoyl)piperidin-2-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1CCCCN1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c17-13-5-4-11(9-14(13)18)16(23)21-8-2-1-3-12(21)10-20-15(22)6-7-19/h4-5,9,12H,1-3,6-8,10,19H2,(H,20,22) |
| InChIKey | GZKXJBRZOHVBEC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |