C15H23ClN4O4S — CID 120579140
3-amino-N-[[1-(5-methyl-4-nitrothiophene-2-carbonyl)piperidin-2-yl]methyl]propanamide;hydrochloride (PubChem CID 120579140) has the molecular formula C15H23ClN4O4S and a molecular weight of 390.89 g/mol. Its IUPAC name is 3-amino-N-[[1-(5-methyl-4-nitrothiophene-2-carbonyl)piperidin-2-yl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[1-(5-methyl-4-nitrothiophene-2-carbonyl)piperidin-2-yl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120579140 |
| Molecular Formula | C15H23ClN4O4S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-amino-N-[[1-(5-methyl-4-nitrothiophene-2-carbonyl)piperidin-2-yl]methyl]propanamide;hydrochloride |
| SMILES | Cc1sc(C(=O)N2CCCCC2CNC(=O)CCN)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H22N4O4S.ClH/c1-10-12(19(22)23)8-13(24-10)15(21)18-7-3-2-4-11(18)9-17-14(20)5-6-16;/h8,11H,2-7,9,16H2,1H3,(H,17,20);1H |
| InChIKey | UHMMBARLGNXYMO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|