C18H22N2O2S — CID 120584317
N-(2-aminoethyl)-N-benzyl-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 120584317) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-benzyl-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 120584317 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | NCCN(Cc1ccccc1)S(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H22N2O2S/c19-11-12-20(14-15-5-2-1-3-6-15)23(21,22)18-10-9-16-7-4-8-17(16)13-18/h1-3,5-6,9-10,13H,4,7-8,11-12,14,19H2 |
| InChIKey | ICMDOPODIVOGKT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |