C21H63ClSi10 — CID 12058468
chloro-tris[methyl-bis(trimethylsilyl)silyl]silane (PubChem CID 12058468) has the molecular formula C21H63ClSi10 and a molecular weight of 632.05 g/mol. Its IUPAC name is chloro-tris[methyl-bis(trimethylsilyl)silyl]silane.
| Compound Name | chloro-tris[methyl-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 12058468 |
| Molecular Formula | C21H63ClSi10 |
| Molecular Weight | 632.05 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | chloro-tris[methyl-bis(trimethylsilyl)silyl]silane |
| SMILES | C[Si](C)(C)[Si](C)([Si](C)(C)C)[Si](Cl)([Si](C)([Si](C)(C)C)[Si](C)(C)C)[Si](C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H63ClSi10/c1-23(2,3)29(19,24(4,5)6)32(22,30(20,25(7,8)9)26(10,11)12)31(21,27(13,14)15)28(16,17)18/h1-21H3 |
| InChIKey | OSYQRKSCRORKGI-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.05 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|