C15H23N3O3S — CID 120584763
3-amino-N-[[1-(benzenesulfonyl)piperidin-2-yl]methyl]propanamide (PubChem CID 120584763) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 3-amino-N-[[1-(benzenesulfonyl)piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-(benzenesulfonyl)piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120584763 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-amino-N-[[1-(benzenesulfonyl)piperidin-2-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H23N3O3S/c16-10-9-15(19)17-12-13-6-4-5-11-18(13)22(20,21)14-7-2-1-3-8-14/h1-3,7-8,13H,4-6,9-12,16H2,(H,17,19) |
| InChIKey | BBYLJGWJWROSAV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |