C13H17F3N2O2S — CID 120584824
N-(2-amino-1-cyclopentylethyl)-2,4,5-trifluorobenzenesulfonamide (PubChem CID 120584824) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-2,4,5-trifluorobenzenesulfonamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-2,4,5-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120584824 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-2,4,5-trifluorobenzenesulfonamide |
| SMILES | NCC(NS(=O)(=O)c1cc(F)c(F)cc1F)C1CCCC1 |
| InChI | InChI=1S/C13H17F3N2O2S/c14-9-5-11(16)13(6-10(9)15)21(19,20)18-12(7-17)8-3-1-2-4-8/h5-6,8,12,18H,1-4,7,17H2 |
| InChIKey | WVKYOUVNNHHAEP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|