C9H18N2O2S — CID 120585589
1-but-3-enylsulfonyl-4-methylpyrrolidin-3-amine (PubChem CID 120585589) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-but-3-enylsulfonyl-4-methylpyrrolidin-3-amine.
| Compound Name | 1-but-3-enylsulfonyl-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120585589 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-but-3-enylsulfonyl-4-methylpyrrolidin-3-amine |
| SMILES | C=CCCS(=O)(=O)N1CC(C)C(N)C1 |
| InChI | InChI=1S/C9H18N2O2S/c1-3-4-5-14(12,13)11-6-8(2)9(10)7-11/h3,8-9H,1,4-7,10H2,2H3 |
| InChIKey | QYJWSQPJLQLNCX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|