C13H20Cl2N2O2 — CID 120587021
4-amino-N-[1-(3-chlorophenyl)ethyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120587021) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 4-amino-N-[1-(3-chlorophenyl)ethyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[1-(3-chlorophenyl)ethyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120587021 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-amino-N-[1-(3-chlorophenyl)ethyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NC(C)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C13H19ClN2O2.ClH/c1-9(10-4-3-5-11(14)6-10)16-13(17)7-12(8-15)18-2;/h3-6,9,12H,7-8,15H2,1-2H3,(H,16,17);1H |
| InChIKey | FJANLHXHYSIUOI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |