C21H27ClN2O2 — CID 120588362
2-amino-N-[(2-cyclopentyloxyphenyl)methyl]-2-phenylpropanamide;hydrochloride (PubChem CID 120588362) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 2-amino-N-[(2-cyclopentyloxyphenyl)methyl]-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[(2-cyclopentyloxyphenyl)methyl]-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120588362 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-amino-N-[(2-cyclopentyloxyphenyl)methyl]-2-phenylpropanamide;hydrochloride |
| SMILES | CC(N)(C(=O)NCc1ccccc1OC1CCCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-21(22,17-10-3-2-4-11-17)20(24)23-15-16-9-5-8-14-19(16)25-18-12-6-7-13-18;/h2-5,8-11,14,18H,6-7,12-13,15,22H2,1H3,(H,23,24);1H |
| InChIKey | ANECUCJDQSKHHJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |