C18H22ClFN2O2 — CID 120588465
4-amino-N-[(4-fluorophenyl)-phenylmethyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120588465) has the molecular formula C18H22ClFN2O2 and a molecular weight of 352.84 g/mol. Its IUPAC name is 4-amino-N-[(4-fluorophenyl)-phenylmethyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[(4-fluorophenyl)-phenylmethyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120588465 |
| Molecular Formula | C18H22ClFN2O2 |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-amino-N-[(4-fluorophenyl)-phenylmethyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NC(c1ccccc1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C18H21FN2O2.ClH/c1-23-16(12-20)11-17(22)21-18(13-5-3-2-4-6-13)14-7-9-15(19)10-8-14;/h2-10,16,18H,11-12,20H2,1H3,(H,21,22);1H |
| InChIKey | MZFXIHQQXLCMER-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |