C20H27ClN2O3 — CID 120588541
4-amino-3-methoxy-N-[[2-(phenylmethoxymethyl)phenyl]methyl]butanamide;hydrochloride (PubChem CID 120588541) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[[2-(phenylmethoxymethyl)phenyl]methyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[[2-(phenylmethoxymethyl)phenyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120588541 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-amino-3-methoxy-N-[[2-(phenylmethoxymethyl)phenyl]methyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NCc1ccccc1COCc1ccccc1.Cl |
| InChI | InChI=1S/C20H26N2O3.ClH/c1-24-19(12-21)11-20(23)22-13-17-9-5-6-10-18(17)15-25-14-16-7-3-2-4-8-16;/h2-10,19H,11-15,21H2,1H3,(H,22,23);1H |
| InChIKey | WPGOGCWJJJGOBM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |