C18H22ClFN2O — CID 120589650
2-amino-N-[2-(4-fluorophenyl)ethyl]-N-methyl-2-phenylpropanamide;hydrochloride (PubChem CID 120589650) has the molecular formula C18H22ClFN2O and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-amino-N-[2-(4-fluorophenyl)ethyl]-N-methyl-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(4-fluorophenyl)ethyl]-N-methyl-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120589650 |
| Molecular Formula | C18H22ClFN2O |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-amino-N-[2-(4-fluorophenyl)ethyl]-N-methyl-2-phenylpropanamide;hydrochloride |
| SMILES | CN(CCc1ccc(F)cc1)C(=O)C(C)(N)c1ccccc1.Cl |
| InChI | InChI=1S/C18H21FN2O.ClH/c1-18(20,15-6-4-3-5-7-15)17(22)21(2)13-12-14-8-10-16(19)11-9-14;/h3-11H,12-13,20H2,1-2H3;1H |
| InChIKey | YLHIOSFKVBLBDU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |