About 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride
4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride (PubChem CID 120590193) has the molecular formula C10H18ClF3N2O2
and a molecular weight of 290.71 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride |
| PubChem CID | 120590193 |
| Molecular Formula | C10H18ClF3N2O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride |
| SMILES | C=CCN(CC(F)(F)F)C(=O)CC(CN)OC.Cl |
| InChI | InChI=1S/C10H17F3N2O2.ClH/c1-3-4-15(7-10(11,12)13)9(16)5-8(6-14)17-2;/h3,8H,1,4-7,14H2,2H3;1H |
| InChIKey | AAPJWSSWOGWWGB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
The IUPAC name of 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride (CID 120590193) is 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride.
What is the SMILES notation for 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
The canonical SMILES for 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride is C=CCN(CC(F)(F)F)C(=O)CC(CN)OC.Cl.
What is the InChIKey of 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
The InChIKey is AAPJWSSWOGWWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2.ClH/c1-3-4-15(7-10(11,12)13)9(16)5-8(6-14)17-2;/h3,8H,1,4-7,14H2,2H3;1H.
What are the key properties of 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride?
4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride has a molecular weight of 290.71 g/mol, XLogP of 1.35, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)butanamide;hydrochloride is sourced from PubChem (CID 120590193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).