6-methylpyridine-2,4-dicarboxylic acid

C8H7NO4 — CID 12059143

IUPAC6-methylpyridine-2,4-dicarboxylic acid
SMILESCc1cc(C(=O)O)cc(C(=O)O)n1
InChIInChI=1S/C8H7NO4/c1-4-2-5(7(10)11)3-6(9-4)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)
InChIKeyKPJDOBLKTXEADO-UHFFFAOYSA-N
MW181.15 g/mol
LogP0.79
Rot. Bonds2

About 6-methylpyridine-2,4-dicarboxylic acid

6-methylpyridine-2,4-dicarboxylic acid (PubChem CID 12059143) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is 6-methylpyridine-2,4-dicarboxylic acid.

Molecular Properties

Compound Name6-methylpyridine-2,4-dicarboxylic acid
PubChem CID12059143
Molecular FormulaC8H7NO4
Molecular Weight181.15 g/mol
Exact Mass181.04
IUPAC Name6-methylpyridine-2,4-dicarboxylic acid
SMILESCc1cc(C(=O)O)cc(C(=O)O)n1
InChIInChI=1S/C8H7NO4/c1-4-2-5(7(10)11)3-6(9-4)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)
InChIKeyKPJDOBLKTXEADO-UHFFFAOYSA-N
XLogP0.79
TPSA87.49 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.15
LogP ≤ 50.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-methylpyridine-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methylpyridine-2,4-dicarboxylic acid?
The IUPAC name of 6-methylpyridine-2,4-dicarboxylic acid (CID 12059143) is 6-methylpyridine-2,4-dicarboxylic acid.
What is the SMILES notation for 6-methylpyridine-2,4-dicarboxylic acid?
The canonical SMILES for 6-methylpyridine-2,4-dicarboxylic acid is Cc1cc(C(=O)O)cc(C(=O)O)n1.
What is the InChIKey of 6-methylpyridine-2,4-dicarboxylic acid?
The InChIKey is KPJDOBLKTXEADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c1-4-2-5(7(10)11)3-6(9-4)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13).
What are the key properties of 6-methylpyridine-2,4-dicarboxylic acid?
6-methylpyridine-2,4-dicarboxylic acid has a molecular weight of 181.15 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridine-2,4-dicarboxylic acid is sourced from PubChem (CID 12059143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).