C15H22N2O2 — CID 120592176
4-amino-N-(2,3-dihydro-1H-inden-1-ylmethyl)-3-methoxybutanamide (PubChem CID 120592176) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-amino-N-(2,3-dihydro-1H-inden-1-ylmethyl)-3-methoxybutanamide.
| Compound Name | 4-amino-N-(2,3-dihydro-1H-inden-1-ylmethyl)-3-methoxybutanamide |
|---|---|
| PubChem CID | 120592176 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-amino-N-(2,3-dihydro-1H-inden-1-ylmethyl)-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)NCC1CCc2ccccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-19-13(9-16)8-15(18)17-10-12-7-6-11-4-2-3-5-14(11)12/h2-5,12-13H,6-10,16H2,1H3,(H,17,18) |
| InChIKey | OFEBFXBLEYJBND-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |