About 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide
4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide (PubChem CID 120592698) has the molecular formula C10H16F2N4O2
and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide.
Molecular Properties
| Compound Name | 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide |
| PubChem CID | 120592698 |
| Molecular Formula | C10H16F2N4O2 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)Nc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C10H16F2N4O2/c1-18-8(3-13)2-10(17)15-7-4-14-16(5-7)6-9(11)12/h4-5,8-9H,2-3,6,13H2,1H3,(H,15,17) |
| InChIKey | VGXUPHAGCUXNIT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide?
The IUPAC name of 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide (CID 120592698) is 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide.
What is the SMILES notation for 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide?
The canonical SMILES for 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide is COC(CN)CC(=O)Nc1cnn(CC(F)F)c1.
What is the InChIKey of 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide?
The InChIKey is VGXUPHAGCUXNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N4O2/c1-18-8(3-13)2-10(17)15-7-4-14-16(5-7)6-9(11)12/h4-5,8-9H,2-3,6,13H2,1H3,(H,15,17).
What are the key properties of 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide?
4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide has a molecular weight of 262.26 g/mol, XLogP of 0.45, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-methoxybutanamide is sourced from PubChem (CID 120592698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).