C17H29Cl2N3O — CID 120595447
2-amino-N-[2-(4-methylpiperidin-1-yl)ethyl]-2-phenylpropanamide;dihydrochloride (PubChem CID 120595447) has the molecular formula C17H29Cl2N3O and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-amino-N-[2-(4-methylpiperidin-1-yl)ethyl]-2-phenylpropanamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(4-methylpiperidin-1-yl)ethyl]-2-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595447 |
| Molecular Formula | C17H29Cl2N3O |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-amino-N-[2-(4-methylpiperidin-1-yl)ethyl]-2-phenylpropanamide;dihydrochloride |
| SMILES | CC1CCN(CCNC(=O)C(C)(N)c2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H27N3O.2ClH/c1-14-8-11-20(12-9-14)13-10-19-16(21)17(2,18)15-6-4-3-5-7-15;;/h3-7,14H,8-13,18H2,1-2H3,(H,19,21);2*1H |
| InChIKey | NSSYTDWJMJOXMJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |