C21H36N6O6 — CID 12059667
2-[2-[4,7-bis[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid (PubChem CID 12059667) has the molecular formula C21H36N6O6 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-[2-[4,7-bis[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid.
| Compound Name | 2-[2-[4,7-bis[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid |
|---|---|
| PubChem CID | 12059667 |
| Molecular Formula | C21H36N6O6 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 2-[2-[4,7-bis[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid |
| SMILES | C/C(=N\CCN1CCN(CC/N=C(\C)C(=O)O)CCN(CC/N=C(\C)C(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C21H36N6O6/c1-16(19(28)29)22-4-7-25-10-12-26(8-5-23-17(2)20(30)31)14-15-27(13-11-25)9-6-24-18(3)21(32)33/h4-15H2,1-3H3,(H,28,29)(H,30,31)(H,32,33)/b22-16+,23-17+,24-18+ |
| InChIKey | DENHLBHGMROLKH-GOQATJGESA-N |
| XLogP | -0.46 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|