C14H24N4O2 — CID 120596704
4-amino-3-methoxy-1-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]butan-1-one (PubChem CID 120596704) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-amino-3-methoxy-1-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-amino-3-methoxy-1-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 120596704 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-amino-3-methoxy-1-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]butan-1-one |
| SMILES | COC(CN)CC(=O)N1CCCC(n2cc(C)cn2)C1 |
| InChI | InChI=1S/C14H24N4O2/c1-11-8-16-18(9-11)12-4-3-5-17(10-12)14(19)6-13(7-15)20-2/h8-9,12-13H,3-7,10,15H2,1-2H3 |
| InChIKey | AEOWRAPGSBJPNG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |