C14H21N3O3S — CID 120599207
N-(2-methylpiperidin-4-yl)-4-(methylsulfamoyl)benzamide (PubChem CID 120599207) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-4-(methylsulfamoyl)benzamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 120599207 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC2CCNC(C)C2)cc1 |
| InChI | InChI=1S/C14H21N3O3S/c1-10-9-12(7-8-16-10)17-14(18)11-3-5-13(6-4-11)21(19,20)15-2/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | XFIOHODDQPMNGE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |