C18H19F3O2Si — CID 12059933
3,3,3-trifluoro-1,2-diphenyl-2-trimethylsilyloxypropan-1-one (PubChem CID 12059933) has the molecular formula C18H19F3O2Si and a molecular weight of 352.43 g/mol. Its IUPAC name is 3,3,3-trifluoro-1,2-diphenyl-2-trimethylsilyloxypropan-1-one.
| Compound Name | 3,3,3-trifluoro-1,2-diphenyl-2-trimethylsilyloxypropan-1-one |
|---|---|
| PubChem CID | 12059933 |
| Molecular Formula | C18H19F3O2Si |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3,3,3-trifluoro-1,2-diphenyl-2-trimethylsilyloxypropan-1-one |
| SMILES | C[Si](C)(C)OC(C(=O)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H19F3O2Si/c1-24(2,3)23-17(18(19,20)21,15-12-8-5-9-13-15)16(22)14-10-6-4-7-11-14/h4-13H,1-3H3 |
| InChIKey | GOKSHJCMPTWPJM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|