C16H23Cl3N2O2 — CID 120600169
4-(2,4-dichlorophenoxy)-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride (PubChem CID 120600169) has the molecular formula C16H23Cl3N2O2 and a molecular weight of 381.73 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120600169 |
| Molecular Formula | C16H23Cl3N2O2 |
| Molecular Weight | 381.73 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(2-methylpiperidin-4-yl)butanamide;hydrochloride |
| SMILES | CC1CC(NC(=O)CCCOc2ccc(Cl)cc2Cl)CCN1.Cl |
| InChI | InChI=1S/C16H22Cl2N2O2.ClH/c1-11-9-13(6-7-19-11)20-16(21)3-2-8-22-15-5-4-12(17)10-14(15)18;/h4-5,10-11,13,19H,2-3,6-9H2,1H3,(H,20,21);1H |
| InChIKey | QMQKOZIGTUPXOP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|