C11H17F3O3 — CID 12060177
ethyl 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 12060177) has the molecular formula C11H17F3O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is ethyl 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 12060177 |
| Molecular Formula | C11H17F3O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O3/c1-2-17-9(15)10(16,11(12,13)14)8-6-4-3-5-7-8/h8,16H,2-7H2,1H3 |
| InChIKey | XDTCGCNROASEEO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |