About 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine
1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine (PubChem CID 120602808) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine.
Molecular Properties
| Compound Name | 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine |
| PubChem CID | 120602808 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine |
| SMILES | Cc1ccc(C/N=C(\N)NC(C)(C)C)c(=O)n1C |
| InChI | InChI=1S/C13H22N4O/c1-9-6-7-10(11(18)17(9)5)8-15-12(14)16-13(2,3)4/h6-7H,8H2,1-5H3,(H3,14,15,16) |
| InChIKey | LMPNIRNWRDBIII-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine?
The IUPAC name of 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine (CID 120602808) is 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine.
What is the SMILES notation for 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine?
The canonical SMILES for 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine is Cc1ccc(C/N=C(\N)NC(C)(C)C)c(=O)n1C.
What is the InChIKey of 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine?
The InChIKey is LMPNIRNWRDBIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O/c1-9-6-7-10(11(18)17(9)5)8-15-12(14)16-13(2,3)4/h6-7H,8H2,1-5H3,(H3,14,15,16).
What are the key properties of 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine?
1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine has a molecular weight of 250.35 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]guanidine is sourced from PubChem (CID 120602808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).