C16H19FN4S — CID 120603174
1-(cyclobutylmethyl)-2-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 120603174) has the molecular formula C16H19FN4S and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 120603174 |
| Molecular Formula | C16H19FN4S |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | N/C(=N\Cc1nc(-c2ccccc2F)cs1)NCC1CCC1 |
| InChI | InChI=1S/C16H19FN4S/c17-13-7-2-1-6-12(13)14-10-22-15(21-14)9-20-16(18)19-8-11-4-3-5-11/h1-2,6-7,10-11H,3-5,8-9H2,(H3,18,19,20) |
| InChIKey | VZRAOQDXMPSNBE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|