C27H32N2O6 — CID 12060405
dimethyl 1-[di(propan-2-yl)amino]-5-oxo-2-(4-phenylmethoxyphenyl)-2H-pyrrole-3,4-dicarboxylate (PubChem CID 12060405) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is dimethyl 1-[di(propan-2-yl)amino]-5-oxo-2-(4-phenylmethoxyphenyl)-2H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-[di(propan-2-yl)amino]-5-oxo-2-(4-phenylmethoxyphenyl)-2H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 12060405 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | dimethyl 1-[di(propan-2-yl)amino]-5-oxo-2-(4-phenylmethoxyphenyl)-2H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccc(OCc3ccccc3)cc2)N(N(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C27H32N2O6/c1-17(2)28(18(3)4)29-24(22(26(31)33-5)23(25(29)30)27(32)34-6)20-12-14-21(15-13-20)35-16-19-10-8-7-9-11-19/h7-15,17-18,24H,16H2,1-6H3 |
| InChIKey | XOBGEKWGWNXYFR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|