C22H30ClN3O3 — CID 120604424
N-(2-aminoethyl)-2-[2-(4-tert-butylphenoxy)propanoylamino]benzamide;hydrochloride (PubChem CID 120604424) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-tert-butylphenoxy)propanoylamino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-tert-butylphenoxy)propanoylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120604424 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-tert-butylphenoxy)propanoylamino]benzamide;hydrochloride |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccccc1C(=O)NCCN.Cl |
| InChI | InChI=1S/C22H29N3O3.ClH/c1-15(28-17-11-9-16(10-12-17)22(2,3)4)20(26)25-19-8-6-5-7-18(19)21(27)24-14-13-23;/h5-12,15H,13-14,23H2,1-4H3,(H,24,27)(H,25,26);1H |
| InChIKey | BPQJJTQVXBTTLY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |