C17H18F3N5O — CID 120604735
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-6-pyrrolidin-1-ylpyridazine-3-carboxamide (PubChem CID 120604735) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-6-pyrrolidin-1-ylpyridazine-3-carboxamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-6-pyrrolidin-1-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 120604735 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-6-pyrrolidin-1-ylpyridazine-3-carboxamide |
| SMILES | NCc1cc(NC(=O)c2ccc(N3CCCC3)nn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N5O/c18-17(19,20)12-7-11(10-21)8-13(9-12)22-16(26)14-3-4-15(24-23-14)25-5-1-2-6-25/h3-4,7-9H,1-2,5-6,10,21H2,(H,22,26) |
| InChIKey | JYQUWLVPPLVACP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |