C16H17NO6 — CID 12060510
dimethyl (3aS,4R,5S,6R)-6-hydroxy-2-oxo-1,3,3a,4,5,6-hexahydrobenzo[de]quinoline-4,5-dicarboxylate (PubChem CID 12060510) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is dimethyl (3aS,4R,5S,6R)-6-hydroxy-2-oxo-1,3,3a,4,5,6-hexahydrobenzo[de]quinoline-4,5-dicarboxylate.
| Compound Name | dimethyl (3aS,4R,5S,6R)-6-hydroxy-2-oxo-1,3,3a,4,5,6-hexahydrobenzo[de]quinoline-4,5-dicarboxylate |
|---|---|
| PubChem CID | 12060510 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | dimethyl (3aS,4R,5S,6R)-6-hydroxy-2-oxo-1,3,3a,4,5,6-hexahydrobenzo[de]quinoline-4,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@@H](O)c2cccc3c2[C@H]1CC(=O)N3 |
| InChI | InChI=1S/C16H17NO6/c1-22-15(20)12-8-6-10(18)17-9-5-3-4-7(11(8)9)14(19)13(12)16(21)23-2/h3-5,8,12-14,19H,6H2,1-2H3,(H,17,18)/t8-,12-,13+,14+/m1/s1 |
| InChIKey | OZPPKVJRZMHPSH-NGSVMEPUSA-N |
| XLogP | 0.74 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |