C16H21IN6O2 — CID 120605829
ethyl 3-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate;hydroiodide (PubChem CID 120605829) has the molecular formula C16H21IN6O2 and a molecular weight of 456.29 g/mol. Its IUPAC name is ethyl 3-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate;hydroiodide.
| Compound Name | ethyl 3-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 120605829 |
| Molecular Formula | C16H21IN6O2 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | ethyl 3-[3-[(1,4,5,6-tetrahydropyrimidin-2-ylamino)methyl]phenyl]-1H-1,2,4-triazole-5-carboxylate;hydroiodide |
| SMILES | CCOC(=O)c1nc(-c2cccc(CNC3=NCCCN3)c2)n[nH]1.I |
| InChI | InChI=1S/C16H20N6O2.HI/c1-2-24-15(23)14-20-13(21-22-14)12-6-3-5-11(9-12)10-19-16-17-7-4-8-18-16;/h3,5-6,9H,2,4,7-8,10H2,1H3,(H2,17,18,19)(H,20,21,22);1H |
| InChIKey | NIGIVEOTHRZEBA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|