C18H32N2O4 — CID 120606285
2-[acetyl-[1-(2,2,4-trimethylpentanoyl)azepan-4-yl]amino]acetic acid (PubChem CID 120606285) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-[acetyl-[1-(2,2,4-trimethylpentanoyl)azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[acetyl-[1-(2,2,4-trimethylpentanoyl)azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 120606285 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[acetyl-[1-(2,2,4-trimethylpentanoyl)azepan-4-yl]amino]acetic acid |
| SMILES | CC(=O)N(CC(=O)O)C1CCCN(C(=O)C(C)(C)CC(C)C)CC1 |
| InChI | InChI=1S/C18H32N2O4/c1-13(2)11-18(4,5)17(24)19-9-6-7-15(8-10-19)20(14(3)21)12-16(22)23/h13,15H,6-12H2,1-5H3,(H,22,23) |
| InChIKey | USOPZCARASGRNB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |