C13H26OSi — CID 12060656
trans-(1S,2S)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexan-1-ol (PubChem CID 12060656) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 12060656 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | trans-(1S,2S)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexan-1-ol |
| SMILES | C[Si](C)(C)C/C=C/C[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C13H26OSi/c1-15(2,3)11-7-6-9-12-8-4-5-10-13(12)14/h6-7,12-14H,4-5,8-11H2,1-3H3/b7-6+/t12-,13-/m0/s1 |
| InChIKey | QDABJRPJRBCWAU-XKZLPGLHSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|