About 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid
2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid (PubChem CID 120606942) has the molecular formula C16H24N4O4S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid |
| PubChem CID | 120606942 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(C(=O)C2CCCN2c2nccs2)CCO1 |
| InChI | InChI=1S/C16H24N4O4S/c1-18(11-14(21)22)9-12-10-19(6-7-24-12)15(23)13-3-2-5-20(13)16-17-4-8-25-16/h4,8,12-13H,2-3,5-7,9-11H2,1H3,(H,21,22) |
| InChIKey | ZVYFQJJGZCIXKO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid?
The IUPAC name of 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid (CID 120606942) is 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid.
What is the SMILES notation for 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid?
The canonical SMILES for 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid is CN(CC(=O)O)CC1CN(C(=O)C2CCCN2c2nccs2)CCO1.
What is the InChIKey of 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid?
The InChIKey is ZVYFQJJGZCIXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O4S/c1-18(11-14(21)22)9-12-10-19(6-7-24-12)15(23)13-3-2-5-20(13)16-17-4-8-25-16/h4,8,12-13H,2-3,5-7,9-11H2,1H3,(H,21,22).
What are the key properties of 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid?
2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid has a molecular weight of 368.46 g/mol, XLogP of 0.36, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[[4-[1-(1,3-thiazol-2-yl)pyrrolidine-2-carbonyl]morpholin-2-yl]methyl]amino]acetic acid is sourced from PubChem (CID 120606942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).