C11H23FN2O2S — CID 120607128
N-[1-(aminomethyl)-2-methylcyclohexyl]-3-fluoropropane-1-sulfonamide (PubChem CID 120607128) has the molecular formula C11H23FN2O2S and a molecular weight of 266.38 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2-methylcyclohexyl]-3-fluoropropane-1-sulfonamide.
| Compound Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-3-fluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 120607128 |
| Molecular Formula | C11H23FN2O2S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-3-fluoropropane-1-sulfonamide |
| SMILES | CC1CCCCC1(CN)NS(=O)(=O)CCCF |
| InChI | InChI=1S/C11H23FN2O2S/c1-10-5-2-3-6-11(10,9-13)14-17(15,16)8-4-7-12/h10,14H,2-9,13H2,1H3 |
| InChIKey | YOPQFIWCPCWWPT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |